C19H8N6S3 — CID 164986620
N-[4-[[cyano(isocyano)methylidene]amino]-10,10-dimethyl-3,7,14-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 164986620) has the molecular formula C19H8N6S3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[4-[[cyano(isocyano)methylidene]amino]-10,10-dimethyl-3,7,14-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | N-[4-[[cyano(isocyano)methylidene]amino]-10,10-dimethyl-3,7,14-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 164986620 |
| Molecular Formula | C19H8N6S3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | N-[4-[[cyano(isocyano)methylidene]amino]-10,10-dimethyl-3,7,14-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]C(C#N)=Nc1cc2sc3c4c(sc3c2s1)C=C(/N=C(\C#N)[N+]#[C-])C4(C)C |
| InChI | InChI=1S/C19H8N6S3/c1-19(2)11(24-12(7-20)22-3)5-9-15(19)17-18(26-9)16-10(27-17)6-14(28-16)25-13(8-21)23-4/h5-6H,1-2H3/b24-12+,25-13? |
| InChIKey | KGMOIKSMOGGAOR-CBLRSEGQSA-N |
| XLogP | 6.12 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|