C24H12N6S4 — CID 164759911
(1E)-N-[6-[(Z)-[cyano(isocyano)methylidene]amino]spiro[3,7,10,13-tetrathiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-17,1'-cyclohexane]-14-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 164759911) has the molecular formula C24H12N6S4 and a molecular weight of 512.67 g/mol. Its IUPAC name is (1E)-N-[6-[(Z)-[cyano(isocyano)methylidene]amino]spiro[3,7,10,13-tetrathiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-17,1'-cyclohexane]-14-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | (1E)-N-[6-[(Z)-[cyano(isocyano)methylidene]amino]spiro[3,7,10,13-tetrathiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-17,1'-cyclohexane]-14-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 164759911 |
| Molecular Formula | C24H12N6S4 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | (1E)-N-[6-[(Z)-[cyano(isocyano)methylidene]amino]spiro[3,7,10,13-tetrathiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-17,1'-cyclohexane]-14-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]/C(C#N)=N\c1cc2sc3c4c(sc3c2s1)-c1sc(/N=C(\C#N)[N+]#[C-])cc1C41CCCCC1 |
| InChI | InChI=1S/C24H12N6S4/c1-27-14(10-25)29-16-8-12-19(32-16)21-18(24(12)6-4-3-5-7-24)22-23(34-21)20-13(31-22)9-17(33-20)30-15(11-26)28-2/h8-9H,3-7H2/b29-14+,30-15- |
| InChIKey | KIVWYXHOWBJKGO-HSXKGJOSSA-N |
| XLogP | 8.42 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|