C28H16N6S2 — CID 165108775
N-[16-[[cyano(isocyano)methylidene]amino]spiro[5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaene-11,1'-cyclohexane]-6-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 165108775) has the molecular formula C28H16N6S2 and a molecular weight of 500.61 g/mol. Its IUPAC name is N-[16-[[cyano(isocyano)methylidene]amino]spiro[5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaene-11,1'-cyclohexane]-6-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | N-[16-[[cyano(isocyano)methylidene]amino]spiro[5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaene-11,1'-cyclohexane]-6-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 165108775 |
| Molecular Formula | C28H16N6S2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-[16-[[cyano(isocyano)methylidene]amino]spiro[5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaene-11,1'-cyclohexane]-6-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]C(C#N)=Nc1cc2cc3c(cc2s1)-c1cc2sc(N=C(C#N)[N+]#[C-])cc2cc1C31CCCCC1 |
| InChI | InChI=1S/C28H16N6S2/c1-31-24(14-29)33-26-10-16-8-20-18(12-22(16)35-26)19-13-23-17(11-27(36-23)34-25(15-30)32-2)9-21(19)28(20)6-4-3-5-7-28/h8-13H,3-7H2 |
| InChIKey | CJENEPVUWGQMPB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|