C18H10N8OS2 — CID 164759983
(1E)-N-[4-(dicyanomethylideneamino)spiro[7-oxa-3,12-dithia-5,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene-8,1'-cyclohexane]-11-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 164759983) has the molecular formula C18H10N8OS2 and a molecular weight of 418.47 g/mol. Its IUPAC name is (1E)-N-[4-(dicyanomethylideneamino)spiro[7-oxa-3,12-dithia-5,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene-8,1'-cyclohexane]-11-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | (1E)-N-[4-(dicyanomethylideneamino)spiro[7-oxa-3,12-dithia-5,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene-8,1'-cyclohexane]-11-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 164759983 |
| Molecular Formula | C18H10N8OS2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (1E)-N-[4-(dicyanomethylideneamino)spiro[7-oxa-3,12-dithia-5,10-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene-8,1'-cyclohexane]-11-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]/C(C#N)=N/c1nc2c(s1)-c1sc(N=C(C#N)C#N)nc1OC21CCCCC1 |
| InChI | InChI=1S/C18H10N8OS2/c1-22-11(9-21)24-17-25-14-12(28-17)13-15(27-18(14)5-3-2-4-6-18)26-16(29-13)23-10(7-19)8-20/h2-6H2/b24-11+ |
| InChIKey | NMQHKGOREUQFFZ-BHGWPJFGSA-N |
| XLogP | 4.41 |
| TPSA | 135.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|