C28H22N6S2 — CID 164759308
CID 164759308 (PubChem CID 164759308) has the molecular formula C28H22N6S2 and a molecular weight of 506.66 g/mol.
| Compound Name | CID 164759308 |
|---|---|
| PubChem CID | 164759308 |
| Molecular Formula | C28H22N6S2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Nc1cc2c(s1)C1=C(c3sc(N=C(C#N)C#N)cc3C13CCCCC3)C21CCCCC1 |
| InChI | InChI=1S/C28H22N6S2/c29-13-17(14-30)33-21-11-19-25(35-21)24-23(27(19)7-3-1-4-8-27)26-20(28(24)9-5-2-6-10-28)12-22(36-26)34-18(15-31)16-32/h11-12H,1-10H2 |
| InChIKey | ZIRORKKVPRQMBI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 119.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|