C25H12N6S4 — CID 165001263
2-[5-[10-[5-(dicyanomethylideneamino)thiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]iminopropanedinitrile (PubChem CID 165001263) has the molecular formula C25H12N6S4 and a molecular weight of 524.68 g/mol. Its IUPAC name is 2-[5-[10-[5-(dicyanomethylideneamino)thiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]iminopropanedinitrile.
| Compound Name | 2-[5-[10-[5-(dicyanomethylideneamino)thiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]iminopropanedinitrile |
|---|---|
| PubChem CID | 165001263 |
| Molecular Formula | C25H12N6S4 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 2-[5-[10-[5-(dicyanomethylideneamino)thiophen-2-yl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]iminopropanedinitrile |
| SMILES | CC1(C)c2cc(-c3ccc(N=C(C#N)C#N)s3)sc2-c2sc(-c3ccc(N=C(C#N)C#N)s3)cc21 |
| InChI | InChI=1S/C25H12N6S4/c1-25(2)15-7-19(17-3-5-21(32-17)30-13(9-26)10-27)34-23(15)24-16(25)8-20(35-24)18-4-6-22(33-18)31-14(11-28)12-29/h3-8H,1-2H3 |
| InChIKey | YYXDSHLVWJNSTA-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 119.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|