C33H30O2S4Si2 — CID 132991922
hydroxy-[5-[10-[5-[hydroxy(dimethyl)silyl]thiophen-2-yl]-7,7-diphenyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-dimethylsilane (PubChem CID 132991922) has the molecular formula C33H30O2S4Si2 and a molecular weight of 643.04 g/mol. Its IUPAC name is hydroxy-[5-[10-[5-[hydroxy(dimethyl)silyl]thiophen-2-yl]-7,7-diphenyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-dimethylsilane.
| Compound Name | hydroxy-[5-[10-[5-[hydroxy(dimethyl)silyl]thiophen-2-yl]-7,7-diphenyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 132991922 |
| Molecular Formula | C33H30O2S4Si2 |
| Molecular Weight | 643.04 g/mol |
| Exact Mass | 642.07 |
| IUPAC Name | hydroxy-[5-[10-[5-[hydroxy(dimethyl)silyl]thiophen-2-yl]-7,7-diphenyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-dimethylsilane |
| SMILES | C[Si](C)(O)c1ccc(-c2cc3c(s2)-c2sc(-c4ccc([Si](C)(C)O)s4)cc2C3(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C33H30O2S4Si2/c1-40(2,34)29-17-15-25(36-29)27-19-23-31(38-27)32-24(20-28(39-32)26-16-18-30(37-26)41(3,4)35)33(23,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-20,34-35H,1-4H3 |
| InChIKey | UCTCTRSIUFGGKG-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.04 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|