C14N10S3 — CID 164974234
N-[14-(dicyanomethylideneamino)-4,10,13-trithia-3,5,8,15-tetrazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 164974234) has the molecular formula C14N10S3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[14-(dicyanomethylideneamino)-4,10,13-trithia-3,5,8,15-tetrazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | N-[14-(dicyanomethylideneamino)-4,10,13-trithia-3,5,8,15-tetrazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 164974234 |
| Molecular Formula | C14N10S3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | N-[14-(dicyanomethylideneamino)-4,10,13-trithia-3,5,8,15-tetrazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaen-9-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]C(C#N)=Nc1nc2c3nsnc3c3nc(N=C(C#N)C#N)sc3c2s1 |
| InChI | InChI=1S/C14N10S3/c1-18-6(4-17)20-14-22-10-8-7(23-27-24-8)9-11(12(10)26-14)25-13(21-9)19-5(2-15)3-16 |
| InChIKey | DXIRFIPJQSIUKT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 152.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|