C26H10N8S4 — CID 165019327
1-isocyano-N-[5-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]methanimidoyl cyanide (PubChem CID 165019327) has the molecular formula C26H10N8S4 and a molecular weight of 562.69 g/mol. Its IUPAC name is 1-isocyano-N-[5-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]methanimidoyl cyanide.
| Compound Name | 1-isocyano-N-[5-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]methanimidoyl cyanide |
|---|---|
| PubChem CID | 165019327 |
| Molecular Formula | C26H10N8S4 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 561.99 |
| IUPAC Name | 1-isocyano-N-[5-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]methanimidoyl cyanide |
| SMILES | [C-]#[N+]/C(C#N)=N/c1cc2c(cc(-c3cc4c(s3)c3sc5ccccc5c3n4C)c3nsnc32)c2nsnc12 |
| InChI | InChI=1S/C26H10N8S4/c1-28-19(10-27)29-15-8-13-12(21-23(15)33-38-31-21)7-14(22-20(13)30-37-32-22)18-9-16-25(36-18)26-24(34(16)2)11-5-3-4-6-17(11)35-26/h3-9H,2H3/b29-19+ |
| InChIKey | QAHNLUKHLPCJAD-VUTHCHCSSA-N |
| XLogP | 7.91 |
| TPSA | 97.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|