C30H19N7S2 — CID 164759236
1-isocyano-N-[4-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]methanimidoyl cyanide (PubChem CID 164759236) has the molecular formula C30H19N7S2 and a molecular weight of 541.67 g/mol. Its IUPAC name is 1-isocyano-N-[4-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]methanimidoyl cyanide.
| Compound Name | 1-isocyano-N-[4-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]methanimidoyl cyanide |
|---|---|
| PubChem CID | 164759236 |
| Molecular Formula | C30H19N7S2 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-isocyano-N-[4-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]methanimidoyl cyanide |
| SMILES | [C-]#[N+]/C(C#N)=N/c1cnc(-c2sc(N(c3ccc(C)cc3)c3ccc(C)cc3)c3ccccc23)c2nsnc12 |
| InChI | InChI=1S/C30H19N7S2/c1-18-8-12-20(13-9-18)37(21-14-10-19(2)11-15-21)30-23-7-5-4-6-22(23)29(38-30)28-27-26(35-39-36-27)24(17-33-28)34-25(16-31)32-3/h4-15,17H,1-2H3/b34-25+ |
| InChIKey | KIMQHMYEOPUCAE-YQCHCMBFSA-N |
| XLogP | 8.53 |
| TPSA | 82.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|