C37H22N6O2S3 — CID 164759223
2-[[5-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,3-dione (PubChem CID 164759223) has the molecular formula C37H22N6O2S3 and a molecular weight of 678.82 g/mol. Its IUPAC name is 2-[[5-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,3-dione.
| Compound Name | 2-[[5-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,3-dione |
|---|---|
| PubChem CID | 164759223 |
| Molecular Formula | C37H22N6O2S3 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.10 |
| IUPAC Name | 2-[[5-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,3-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3cc4c(cc(N=c5c(=O)c6ccccc6c5=O)c5nsnc54)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C37H22N6O2S3/c1-19-7-11-21(12-8-19)43(22-13-9-20(2)10-14-22)30-16-15-29(46-30)27-17-25-26(31-33(27)41-47-39-31)18-28(34-32(25)40-48-42-34)38-35-36(44)23-5-3-4-6-24(23)37(35)45/h3-18H,1-2H3 |
| InChIKey | VOFPIMAFPJKMPC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |