C33H26F2N4O2S2 — CID 165022113
5,7-difluoro-3-[[7-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione (PubChem CID 165022113) has the molecular formula C33H26F2N4O2S2 and a molecular weight of 612.73 g/mol. Its IUPAC name is 5,7-difluoro-3-[[7-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione.
| Compound Name | 5,7-difluoro-3-[[7-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
|---|---|
| PubChem CID | 165022113 |
| Molecular Formula | C33H26F2N4O2S2 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 5,7-difluoro-3-[[7-[5-(4-methyl-N-(4-methylphenyl)anilino)thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(/N=C4\C(=O)C(=O)C5C(F)CC(F)CC45)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C33H26F2N4O2S2/c1-17-3-7-20(8-4-17)39(21-9-5-18(2)6-10-21)27-14-13-26(42-27)22-11-12-25(31-29(22)37-43-38-31)36-30-23-15-19(34)16-24(35)28(23)32(40)33(30)41/h3-14,19,23-24,28H,15-16H2,1-2H3/b36-30- |
| InChIKey | CAZPEDGQDGLBRH-BBTNWVSFSA-N |
| XLogP | 8.43 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|