C40H23F3N6O2S2 — CID 164759554
3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-6-(trifluoromethyl)indene-1,2-dione (PubChem CID 164759554) has the molecular formula C40H23F3N6O2S2 and a molecular weight of 740.79 g/mol. Its IUPAC name is 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-6-(trifluoromethyl)indene-1,2-dione.
| Compound Name | 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-6-(trifluoromethyl)indene-1,2-dione |
|---|---|
| PubChem CID | 164759554 |
| Molecular Formula | C40H23F3N6O2S2 |
| Molecular Weight | 740.79 g/mol |
| Exact Mass | 740.13 |
| IUPAC Name | 3-[[5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazol-10-yl]imino]-6-(trifluoromethyl)indene-1,2-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3cc4c(cc(/N=c5\c(=O)c(=O)c6cc(C(F)(F)F)ccc56)c5nsnc54)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C40H23F3N6O2S2/c1-20-3-10-24(11-4-20)49(25-12-5-21(2)6-13-25)26-14-7-22(8-15-26)28-18-29-30(34-33(28)45-52-46-34)19-32(37-35(29)47-53-48-37)44-36-27-16-9-23(40(41,42)43)17-31(27)38(50)39(36)51/h3-19H,1-2H3/b44-36- |
| InChIKey | UZOBITVJEISPHP-XIPYOLKMSA-N |
| XLogP | 9.60 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.79 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|