C41H22F2N6O2S3 — CID 164759206
5,7-difluoro-3-[[5-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,2-dione (PubChem CID 164759206) has the molecular formula C41H22F2N6O2S3 and a molecular weight of 764.86 g/mol. Its IUPAC name is 5,7-difluoro-3-[[5-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,2-dione.
| Compound Name | 5,7-difluoro-3-[[5-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,2-dione |
|---|---|
| PubChem CID | 164759206 |
| Molecular Formula | C41H22F2N6O2S3 |
| Molecular Weight | 764.86 g/mol |
| Exact Mass | 764.09 |
| IUPAC Name | 5,7-difluoro-3-[[5-[3-(4-methyl-N-(4-methylphenyl)anilino)-2-benzothiophen-1-yl]-[2,1,3]benzothiadiazolo[4,5-g][2,1,3]benzothiadiazol-10-yl]imino]indene-1,2-dione |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2sc(-c3cc4c(cc(/N=c5\c(=O)c(=O)c6c(F)cc(F)cc56)c5nsnc54)c4nsnc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C41H22F2N6O2S3/c1-19-7-11-22(12-8-19)49(23-13-9-20(2)10-14-23)41-25-6-4-3-5-24(25)40(52-41)29-17-26-27(33-35(29)47-53-45-33)18-31(37-34(26)46-54-48-37)44-36-28-15-21(42)16-30(43)32(28)38(50)39(36)51/h3-18H,1-2H3/b44-36- |
| InChIKey | SZYFGEBZPRNPHQ-XIPYOLKMSA-N |
| XLogP | 10.08 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.86 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|