C16H15ClF3N3O — CID 164987428
6-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-5-(trifluoromethyl)pyridazin-3-amine (PubChem CID 164987428) has the molecular formula C16H15ClF3N3O and a molecular weight of 357.76 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-5-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | 6-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-5-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 164987428 |
| Molecular Formula | C16H15ClF3N3O |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-5-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1cc(NC[C@H]2CCCO2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClF3N3O/c17-11-5-3-10(4-6-11)15-13(16(18,19)20)8-14(22-23-15)21-9-12-2-1-7-24-12/h3-6,8,12H,1-2,7,9H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | GJALAEWBFVCQFE-GFCCVEGCSA-N |
| XLogP | 4.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |