C21H32N4O8 — CID 164991773
5-O-tert-butyl 3-O-ethyl 3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3,5-dicarboxylate;ethyl 4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 164991773) has the molecular formula C21H32N4O8 and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-ethyl 3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3,5-dicarboxylate;ethyl 4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate.
| Compound Name | 5-O-tert-butyl 3-O-ethyl 3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3,5-dicarboxylate;ethyl 4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 164991773 |
| Molecular Formula | C21H32N4O8 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-O-tert-butyl 3-O-ethyl 3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3,5-dicarboxylate;ethyl 4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2CN(C(=O)OC(C)(C)C)CC12.CCOC(=O)C1=NOC2CNCC12 |
| InChI | InChI=1S/C13H20N2O5.C8H12N2O3/c1-5-18-11(16)10-8-6-15(7-9(8)20-14-10)12(17)19-13(2,3)4;1-2-12-8(11)7-5-3-9-4-6(5)13-10-7/h8-9H,5-7H2,1-4H3;5-6,9H,2-4H2,1H3 |
| InChIKey | GYNRWXQXNANNFQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|