C22H27N3 — CID 165000125
ethane;2-(9H-fluoren-4-yl)-4,6-dimethyl-1,3,5-triazine (PubChem CID 165000125) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is ethane;2-(9H-fluoren-4-yl)-4,6-dimethyl-1,3,5-triazine.
| Compound Name | ethane;2-(9H-fluoren-4-yl)-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 165000125 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | ethane;2-(9H-fluoren-4-yl)-4,6-dimethyl-1,3,5-triazine |
| SMILES | CC.CC.Cc1nc(C)nc(-c2cccc3c2-c2ccccc2C3)n1 |
| InChI | InChI=1S/C18H15N3.2C2H6/c1-11-19-12(2)21-18(20-11)16-9-5-7-14-10-13-6-3-4-8-15(13)17(14)16;2*1-2/h3-9H,10H2,1-2H3;2*1-2H3 |
| InChIKey | IDDPUDIVXVQVFU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |