C10H9Cl2NO2 — CID 165000552
1-(3,5-dichloro-2-pyridinyl)pentane-1,4-dione (PubChem CID 165000552) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)pentane-1,4-dione.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 165000552 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO2/c1-6(14)2-3-9(15)10-8(12)4-7(11)5-13-10/h4-5H,2-3H2,1H3 |
| InChIKey | PQQNDOFRJDYJCL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |