4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid

C9H7Cl2NO3 — CID 79780666

IUPAC4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)c1ncc(Cl)cc1Cl
InChIInChI=1S/C9H7Cl2NO3/c10-5-3-6(11)9(12-4-5)7(13)1-2-8(14)15/h3-4H,1-2H2,(H,14,15)
InChIKeyCNEVFCROLHXDOW-UHFFFAOYSA-N
MW248.06 g/mol
LogP2.44
Rot. Bonds4

About 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid

4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid (PubChem CID 79780666) has the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid
PubChem CID79780666
Molecular FormulaC9H7Cl2NO3
Molecular Weight248.06 g/mol
Exact Mass246.98
IUPAC Name4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)c1ncc(Cl)cc1Cl
InChIInChI=1S/C9H7Cl2NO3/c10-5-3-6(11)9(12-4-5)7(13)1-2-8(14)15/h3-4H,1-2H2,(H,14,15)
InChIKeyCNEVFCROLHXDOW-UHFFFAOYSA-N
XLogP2.44
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.06
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid?
The IUPAC name of 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid (CID 79780666) is 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid?
The canonical SMILES for 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid is O=C(O)CCC(=O)c1ncc(Cl)cc1Cl.
What is the InChIKey of 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid?
The InChIKey is CNEVFCROLHXDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO3/c10-5-3-6(11)9(12-4-5)7(13)1-2-8(14)15/h3-4H,1-2H2,(H,14,15).
What are the key properties of 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid?
4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid has a molecular weight of 248.06 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid is sourced from PubChem (CID 79780666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).