C9H7Cl2NO3 — CID 79780666
4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid (PubChem CID 79780666) has the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid.
| Compound Name | 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79780666 |
| Molecular Formula | C9H7Cl2NO3 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 4-(3,5-dichloro-2-pyridinyl)-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2NO3/c10-5-3-6(11)9(12-4-5)7(13)1-2-8(14)15/h3-4H,1-2H2,(H,14,15) |
| InChIKey | CNEVFCROLHXDOW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |