C9H7Cl2NO — CID 79786695
cyclopropyl-(3,5-dichloro-2-pyridinyl)methanone (PubChem CID 79786695) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is cyclopropyl-(3,5-dichloro-2-pyridinyl)methanone.
| Compound Name | cyclopropyl-(3,5-dichloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 79786695 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | cyclopropyl-(3,5-dichloro-2-pyridinyl)methanone |
| SMILES | O=C(c1ncc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C9H7Cl2NO/c10-6-3-7(11)8(12-4-6)9(13)5-1-2-5/h3-5H,1-2H2 |
| InChIKey | WQFQQFPNJWEDNQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |