C15H23FO3 — CID 165001222
(2-fluoro-2-methylpropyl) 3-ethyl-5-formyl-1-methylcyclohex-3-ene-1-carboxylate (PubChem CID 165001222) has the molecular formula C15H23FO3 and a molecular weight of 270.34 g/mol. Its IUPAC name is (2-fluoro-2-methylpropyl) 3-ethyl-5-formyl-1-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | (2-fluoro-2-methylpropyl) 3-ethyl-5-formyl-1-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 165001222 |
| Molecular Formula | C15H23FO3 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2-fluoro-2-methylpropyl) 3-ethyl-5-formyl-1-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCC1=CC(C=O)CC(C)(C(=O)OCC(C)(C)F)C1 |
| InChI | InChI=1S/C15H23FO3/c1-5-11-6-12(9-17)8-15(4,7-11)13(18)19-10-14(2,3)16/h6,9,12H,5,7-8,10H2,1-4H3 |
| InChIKey | IGZPWIACJSYDJK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|