C34H70O4Si2 — CID 165010108
2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3,4-dimethylcyclohexane-1,2-diol (PubChem CID 165010108) has the molecular formula C34H70O4Si2 and a molecular weight of 599.10 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3,4-dimethylcyclohexane-1,2-diol.
| Compound Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3,4-dimethylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 165010108 |
| Molecular Formula | C34H70O4Si2 |
| Molecular Weight | 599.10 g/mol |
| Exact Mass | 598.48 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3,4-dimethylcyclohexane-1,2-diol |
| SMILES | CC1C(CO[Si](C)(C)C(C)(C)C(C)C)CC(O)C(O)C1C.CC1C=CCC(CO[Si](C)(C)C(C)(C)C(C)C)C1C |
| InChI | InChI=1S/C17H36O3Si.C17H34OSi/c1-11(2)17(5,6)21(7,8)20-10-14-9-15(18)16(19)13(4)12(14)3;1-13(2)17(5,6)19(7,8)18-12-16-11-9-10-14(3)15(16)4/h11-16,18-19H,9-10H2,1-8H3;9-10,13-16H,11-12H2,1-8H3 |
| InChIKey | JOMVEJIHTDQRIY-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.10 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|