C25H18F3N3O — CID 165013877
4-methyl-N-(3-phenyl-1H-isoindol-5-yl)-6-(trifluoromethyl)-3H-isoindole-5-carboxamide (PubChem CID 165013877) has the molecular formula C25H18F3N3O and a molecular weight of 433.43 g/mol. Its IUPAC name is 4-methyl-N-(3-phenyl-1H-isoindol-5-yl)-6-(trifluoromethyl)-3H-isoindole-5-carboxamide.
| Compound Name | 4-methyl-N-(3-phenyl-1H-isoindol-5-yl)-6-(trifluoromethyl)-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 165013877 |
| Molecular Formula | C25H18F3N3O |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-methyl-N-(3-phenyl-1H-isoindol-5-yl)-6-(trifluoromethyl)-3H-isoindole-5-carboxamide |
| SMILES | Cc1c2c(cc(C(F)(F)F)c1C(=O)Nc1ccc3c(c1)C(c1ccccc1)=NC3)C=NC2 |
| InChI | InChI=1S/C25H18F3N3O/c1-14-20-13-29-11-17(20)9-21(25(26,27)28)22(14)24(32)31-18-8-7-16-12-30-23(19(16)10-18)15-5-3-2-4-6-15/h2-11H,12-13H2,1H3,(H,31,32) |
| InChIKey | KCNMBAYURMFIHP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |