C16H8Br4F3NO3 — CID 88887337
2,3,4,5-tetrabromo-6-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoyl]benzoic acid (PubChem CID 88887337) has the molecular formula C16H8Br4F3NO3 and a molecular weight of 638.85 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88887337 |
| Molecular Formula | C16H8Br4F3NO3 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 634.72 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)c2c(Br)c(Br)c(Br)c(Br)c2C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H8Br4F3NO3/c1-5-2-3-6(4-7(5)16(21,22)23)24-14(25)8-9(15(26)27)11(18)13(20)12(19)10(8)17/h2-4H,1H3,(H,24,25)(H,26,27) |
| InChIKey | QJVXFEXREJYPPK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|