C23H30N2O7S — CID 16501429
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate (PubChem CID 16501429) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 16501429 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccc(S(=O)(=O)N(C)C)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C23H30N2O7S/c1-16(2)12-13-31-20-11-6-17(14-21(20)30-5)23(27)32-15-22(26)24-18-7-9-19(10-8-18)33(28,29)25(3)4/h6-11,14,16H,12-13,15H2,1-5H3,(H,24,26) |
| InChIKey | YLKMBPCXFGMINK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |