C22H27ClN2O7S — CID 42965162
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate (PubChem CID 42965162) has the molecular formula C22H27ClN2O7S and a molecular weight of 498.99 g/mol. Its IUPAC name is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 42965162 |
| Molecular Formula | C22H27ClN2O7S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N(C)C)c2)cc1OC |
| InChI | InChI=1S/C22H27ClN2O7S/c1-5-6-11-31-18-10-7-15(12-19(18)30-4)22(27)32-14-21(26)24-16-8-9-17(23)20(13-16)33(28,29)25(2)3/h7-10,12-13H,5-6,11,14H2,1-4H3,(H,24,26) |
| InChIKey | ZIWJZHRTNILYKJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|