C17H25NO3Si — CID 165021491
3-silylpropyl 3-[2-[(E)-2-phenylethenyl]-1,3-oxazolidin-3-yl]propanoate (PubChem CID 165021491) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is 3-silylpropyl 3-[2-[(E)-2-phenylethenyl]-1,3-oxazolidin-3-yl]propanoate.
| Compound Name | 3-silylpropyl 3-[2-[(E)-2-phenylethenyl]-1,3-oxazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 165021491 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-silylpropyl 3-[2-[(E)-2-phenylethenyl]-1,3-oxazolidin-3-yl]propanoate |
| SMILES | O=C(CCN1CCOC1/C=C/c1ccccc1)OCCC[SiH3] |
| InChI | InChI=1S/C17H25NO3Si/c19-17(21-12-4-14-22)9-10-18-11-13-20-16(18)8-7-15-5-2-1-3-6-15/h1-3,5-8,16H,4,9-14H2,22H3/b8-7+ |
| InChIKey | LFNSNGDZVLGZBZ-BQYQJAHWSA-N |
| XLogP | 1.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|