C25H19FN4O2S2 — CID 16502372
3-(2-fluorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 16502372) has the molecular formula C25H19FN4O2S2 and a molecular weight of 490.59 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-fluorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 16502372 |
| Molecular Formula | C25H19FN4O2S2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 3-(2-fluorophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2nc(SCc2nnc(-c4ccccc4)o2)n1-c1ccccc1F)CCCC3 |
| InChI | InChI=1S/C25H19FN4O2S2/c26-17-11-5-6-12-18(17)30-24(31)21-16-10-4-7-13-19(16)34-23(21)27-25(30)33-14-20-28-29-22(32-20)15-8-2-1-3-9-15/h1-3,5-6,8-9,11-12H,4,7,10,13-14H2 |
| InChIKey | RPBPEHLBAJMRNC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |