C21H19ClN4O2S2 — CID 24577260
3-(4-chlorophenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24577260) has the molecular formula C21H19ClN4O2S2 and a molecular weight of 459.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24577260 |
| Molecular Formula | C21H19ClN4O2S2 |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCc1nnc(CSc2nc3sc4c(c3c(=O)n2-c2ccc(Cl)cc2)CCCC4)o1 |
| InChI | InChI=1S/C21H19ClN4O2S2/c1-2-16-24-25-17(28-16)11-29-21-23-19-18(14-5-3-4-6-15(14)30-19)20(27)26(21)13-9-7-12(22)8-10-13/h7-10H,2-6,11H2,1H3 |
| InChIKey | NADPRTPYZIPHMJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |