About (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine
(2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine (PubChem CID 165034440) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine.
Analyze (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine?
The IUPAC name of (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine (CID 165034440) is (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine?
The canonical SMILES for (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine is C[C@@H]1N=CC=C(F)[C@@H]1C.
What is the InChIKey of (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine?
The InChIKey is NDWKJMHTTGDGAX-RITPCOANSA-N. The full InChI is InChI=1S/C7H10FN/c1-5-6(2)9-4-3-7(5)8/h3-6H,1-2H3/t5-,6+/m1/s1.
What are the key properties of (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine?
(2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine has a molecular weight of 127.16 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-4-fluoro-2,3-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 165034440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).