C42H36N4O4S3 — CID 165035657
CID 165035657 (PubChem CID 165035657) has the molecular formula C42H36N4O4S3 and a molecular weight of 756.98 g/mol.
| Compound Name | CID 165035657 |
|---|---|
| PubChem CID | 165035657 |
| Molecular Formula | C42H36N4O4S3 |
| Molecular Weight | 756.98 g/mol |
| Exact Mass | 756.19 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C1=C(C)/C(=C\c2cc3c(s2)-c2sc4c(c2C32CCCCC2)C2(CCCCC2)c2cc(/C=C3/C(=O)N(C)C(=O)C(C#N)=C3C)sc2-4)C(=O)N(C)C1=O |
| InChI | InChI=1S/C42H36N4O4S3/c1-21-25(37(47)45(4)39(49)27(21)20-43)16-23-18-28-33(51-23)35-30(41(28)12-8-6-9-13-41)31-36(53-35)34-29(42(31)14-10-7-11-15-42)19-24(52-34)17-26-22(2)32(44-3)40(50)46(5)38(26)48/h16-19H,6-15H2,1-2,4-5H3/b25-16+,26-17+ |
| InChIKey | GZNFKVSNRDYHDV-ZZZAPRPPSA-N |
| XLogP | 9.13 |
| TPSA | 102.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.98 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|