C24H30N8O6 — CID 165036335
ethyl 2-(1-cyanoethyl)pyrazole-3-carboxylate;ethyl 1-(1-isocyanoethyl)pyrazole-3-carboxylate;ethyl 1H-pyrazole-5-carboxylate (PubChem CID 165036335) has the molecular formula C24H30N8O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is ethyl 2-(1-cyanoethyl)pyrazole-3-carboxylate;ethyl 1-(1-isocyanoethyl)pyrazole-3-carboxylate;ethyl 1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 2-(1-cyanoethyl)pyrazole-3-carboxylate;ethyl 1-(1-isocyanoethyl)pyrazole-3-carboxylate;ethyl 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 165036335 |
| Molecular Formula | C24H30N8O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | ethyl 2-(1-cyanoethyl)pyrazole-3-carboxylate;ethyl 1-(1-isocyanoethyl)pyrazole-3-carboxylate;ethyl 1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccn[nH]1.CCOC(=O)c1ccnn1C(C)C#N.[C-]#[N+]C(C)n1ccc(C(=O)OCC)n1 |
| InChI | InChI=1S/2C9H11N3O2.C6H8N2O2/c1-4-14-9(13)8-5-6-12(11-8)7(2)10-3;1-3-14-9(13)8-4-5-11-12(8)7(2)6-10;1-2-10-6(9)5-3-4-7-8-5/h5-7H,4H2,1-2H3;4-5,7H,3H2,1-2H3;3-4H,2H2,1H3,(H,7,8) |
| InChIKey | NKXKJZZCFXQXOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|