C32H33BN3O4 — CID 165041537
CID 165041537 (PubChem CID 165041537) has the molecular formula C32H33BN3O4 and a molecular weight of 534.45 g/mol.
| Compound Name | CID 165041537 |
|---|---|
| PubChem CID | 165041537 |
| Molecular Formula | C32H33BN3O4 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | — |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1c1ccccc1C(=O)N(C(=O)NC1CCCCC1)C1CCCCC1.[B] |
| InChI | InChI=1S/C32H33N3O4.B/c36-29(34(23-15-5-2-6-16-23)32(39)33-22-13-3-1-4-14-22)24-17-7-8-20-27(24)35-30(37)25-18-9-11-21-12-10-19-26(28(21)25)31(35)38;/h7-12,17-20,22-23H,1-6,13-16H2,(H,33,39); |
| InChIKey | MKDKLXXEHOXHLG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|