C22H22N2O3 — CID 168517830
N-cycloheptyl-2-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 168517830) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-cycloheptyl-2-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-cycloheptyl-2-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 168517830 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-cycloheptyl-2-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O3/c25-20(23-15-9-3-1-2-4-10-15)18-13-7-8-14-19(18)24-21(26)16-11-5-6-12-17(16)22(24)27/h5-8,11-15H,1-4,9-10H2,(H,23,25) |
| InChIKey | UKPFLKJZQFZRKF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|