C22H23N3O3 — CID 110352303
1-cyclohexyl-3-[5-(1,3-dioxoisoindol-2-yl)-2-methylphenyl]urea (PubChem CID 110352303) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[5-(1,3-dioxoisoindol-2-yl)-2-methylphenyl]urea.
| Compound Name | 1-cyclohexyl-3-[5-(1,3-dioxoisoindol-2-yl)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 110352303 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-cyclohexyl-3-[5-(1,3-dioxoisoindol-2-yl)-2-methylphenyl]urea |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3C2=O)cc1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-11-12-16(25-20(26)17-9-5-6-10-18(17)21(25)27)13-19(14)24-22(28)23-15-7-3-2-4-8-15/h5-6,9-13,15H,2-4,7-8H2,1H3,(H2,23,24,28) |
| InChIKey | TXEOZSFABUDBPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|