C25H28N4O4 — CID 56509969
4-(cyclohexylcarbamoylamino)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide (PubChem CID 56509969) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 56509969 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H28N4O4/c30-22(14-7-15-26-25(33)28-17-8-2-1-3-9-17)27-18-10-6-11-19(16-18)29-23(31)20-12-4-5-13-21(20)24(29)32/h4-6,10-13,16-17H,1-3,7-9,14-15H2,(H,27,30)(H2,26,28,33) |
| InChIKey | MTJRRSHYXSWOLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|