C24H32FeN2O2+2 — CID 11224354
CID 11224354 (PubChem CID 11224354) has the molecular formula C24H32FeN2O2+2 and a molecular weight of 436.38 g/mol.
| Compound Name | CID 11224354 |
|---|---|
| PubChem CID | 11224354 |
| Molecular Formula | C24H32FeN2O2+2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | — |
| SMILES | O=C(NC1CCCCC1)N(C(=O)[C]1[CH][CH][CH][CH]1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C19H27N2O2.C5H5.Fe/c22-18(15-9-7-8-10-15)21(17-13-5-2-6-14-17)19(23)20-16-11-3-1-4-12-16;1-2-4-5-3-1;/h7-10,16-17H,1-6,11-14H2,(H,20,23);1-5H;/q;;+2 |
| InChIKey | RZWITRJMHUMOQB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|