C25H27FN9O3Si — CID 165054516
CID 165054516 (PubChem CID 165054516) has the molecular formula C25H27FN9O3Si and a molecular weight of 548.64 g/mol.
| Compound Name | CID 165054516 |
|---|---|
| PubChem CID | 165054516 |
| Molecular Formula | C25H27FN9O3Si |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | — |
| SMILES | CCN(C)C(=O)Nc1ccc(-c2c3nc4c(cnn4c2N)C(=O)NC[Si](C)Oc2ncc(F)cc2CN3)cc1 |
| InChI | InChI=1S/C25H27FN9O3Si/c1-4-34(2)25(37)32-17-7-5-14(6-8-17)19-20(27)35-22-18(12-31-35)23(36)30-13-39(3)38-24-15(9-16(26)11-29-24)10-28-21(19)33-22/h5-9,11-12H,4,10,13,27H2,1-3H3,(H,28,33)(H,30,36)(H,32,37) |
| InChIKey | OUCKHLIDJXSXJD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|