C22H21FN8O2 — CID 168841808
(11S)-19-amino-20-(4-aminophenyl)-6-fluoro-11-methyl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one (PubChem CID 168841808) has the molecular formula C22H21FN8O2 and a molecular weight of 448.46 g/mol. Its IUPAC name is (11S)-19-amino-20-(4-aminophenyl)-6-fluoro-11-methyl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one.
| Compound Name | (11S)-19-amino-20-(4-aminophenyl)-6-fluoro-11-methyl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one |
|---|---|
| PubChem CID | 168841808 |
| Molecular Formula | C22H21FN8O2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (11S)-19-amino-20-(4-aminophenyl)-6-fluoro-11-methyl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4(9),5,7,15(22),16,19-heptaen-14-one |
| SMILES | C[C@H]1CNC(=O)c2cnn3c(N)c(-c4ccc(N)cc4)c(nc23)NCc2cc(F)cnc2O1 |
| InChI | InChI=1S/C22H21FN8O2/c1-11-7-27-21(32)16-10-29-31-18(25)17(12-2-4-15(24)5-3-12)19(30-20(16)31)26-8-13-6-14(23)9-28-22(13)33-11/h2-6,9-11H,7-8,24-25H2,1H3,(H,26,30)(H,27,32)/t11-/m0/s1 |
| InChIKey | JBBBHABJYVFIKN-NSHDSACASA-N |
| XLogP | 2.22 |
| TPSA | 145.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|