C21H20FN8O2Si — CID 163671158
CID 163671158 (PubChem CID 163671158) has the molecular formula C21H20FN8O2Si and a molecular weight of 463.53 g/mol.
| Compound Name | CID 163671158 |
|---|---|
| PubChem CID | 163671158 |
| Molecular Formula | C21H20FN8O2Si |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | — |
| SMILES | C[Si]1CNC(=O)c2cnn3c(N)c(-c4ccc(N)cc4)c(nc23)NCc2cc(F)cnc2O1 |
| InChI | InChI=1S/C21H20FN8O2Si/c1-33-10-27-20(31)15-9-28-30-17(24)16(11-2-4-14(23)5-3-11)18(29-19(15)30)25-7-12-6-13(22)8-26-21(12)32-33/h2-6,8-9H,7,10,23-24H2,1H3,(H,25,29)(H,27,31) |
| InChIKey | JPBHPQPBTASHMO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 145.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|