C25H19FN8O3Si — CID 174045703
CID 174045703 (PubChem CID 174045703) has the molecular formula C25H19FN8O3Si and a molecular weight of 526.56 g/mol.
| Compound Name | CID 174045703 |
|---|---|
| PubChem CID | 174045703 |
| Molecular Formula | C25H19FN8O3Si |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | — |
| SMILES | C[C@]12Oc3ncc(F)cc3CNc3nc4c(cnn4cc3-c3ccc(Nc4ncco4)cc3)C(=O)NC1[Si]2 |
| InChI | InChI=1S/C25H19FN8O3Si/c1-25-23(38-25)33-21(35)17-11-30-34-12-18(13-2-4-16(5-3-13)31-24-27-6-7-36-24)19(32-20(17)34)28-9-14-8-15(26)10-29-22(14)37-25/h2-8,10-12,23H,9H2,1H3,(H,27,31)(H,28,32)(H,33,35)/t23?,25-/m1/s1 |
| InChIKey | DEVKVKMVMXYSOJ-XSWBTSGESA-N |
| XLogP | 3.16 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|