C43H58N8O6 — CID 165061229
3-[4-[4-[11-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methylamino]-10-oxoundecyl]piperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 165061229) has the molecular formula C43H58N8O6 and a molecular weight of 782.99 g/mol. Its IUPAC name is 3-[4-[4-[11-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methylamino]-10-oxoundecyl]piperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[11-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methylamino]-10-oxoundecyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165061229 |
| Molecular Formula | C43H58N8O6 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.45 |
| IUPAC Name | 3-[4-[4-[11-[[4-(1,6-dimethyl-7-oxopyrazolo[5,4-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methylamino]-10-oxoundecyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3c2cnn3C)cc(OC)c1CNCC(=O)CCCCCCCCCN1CCN(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C43H58N8O6/c1-48-29-36(34-28-45-49(2)41(34)43(48)55)30-24-38(56-3)35(39(25-30)57-4)27-44-26-33(52)12-10-8-6-5-7-9-11-19-50-20-22-51(23-21-50)32-15-13-31(14-16-32)46-37-17-18-40(53)47-42(37)54/h13-16,24-25,28-29,37,44,46H,5-12,17-23,26-27H2,1-4H3,(H,47,53,54) |
| InChIKey | YQAAEUJUJGUJMF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|