C11H21FN2O — CID 165064974
3-(1-fluoroethyl)-N-[(2R)-3-methylbutan-2-yl]azetidine-1-carboxamide (PubChem CID 165064974) has the molecular formula C11H21FN2O and a molecular weight of 216.30 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-N-[(2R)-3-methylbutan-2-yl]azetidine-1-carboxamide.
| Compound Name | 3-(1-fluoroethyl)-N-[(2R)-3-methylbutan-2-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 165064974 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(1-fluoroethyl)-N-[(2R)-3-methylbutan-2-yl]azetidine-1-carboxamide |
| SMILES | CC(F)C1CN(C(=O)N[C@H](C)C(C)C)C1 |
| InChI | InChI=1S/C11H21FN2O/c1-7(2)9(4)13-11(15)14-5-10(6-14)8(3)12/h7-10H,5-6H2,1-4H3,(H,13,15)/t8?,9-/m1/s1 |
| InChIKey | WLIHNMLMEICMJL-YGPZHTELSA-N |
| XLogP | 2.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |