C18H18Br2F2O5 — CID 165065987
2-bromo-5-fluorobenzaldehyde;2-(2-bromo-5-fluorophenyl)-1,3-dioxolane;ethane-1,2-diol (PubChem CID 165065987) has the molecular formula C18H18Br2F2O5 and a molecular weight of 512.14 g/mol. Its IUPAC name is 2-bromo-5-fluorobenzaldehyde;2-(2-bromo-5-fluorophenyl)-1,3-dioxolane;ethane-1,2-diol.
| Compound Name | 2-bromo-5-fluorobenzaldehyde;2-(2-bromo-5-fluorophenyl)-1,3-dioxolane;ethane-1,2-diol |
|---|---|
| PubChem CID | 165065987 |
| Molecular Formula | C18H18Br2F2O5 |
| Molecular Weight | 512.14 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | 2-bromo-5-fluorobenzaldehyde;2-(2-bromo-5-fluorophenyl)-1,3-dioxolane;ethane-1,2-diol |
| SMILES | Fc1ccc(Br)c(C2OCCO2)c1.O=Cc1cc(F)ccc1Br.OCCO |
| InChI | InChI=1S/C9H8BrFO2.C7H4BrFO.C2H6O2/c10-8-2-1-6(11)5-7(8)9-12-3-4-13-9;8-7-2-1-6(9)3-5(7)4-10;3-1-2-4/h1-2,5,9H,3-4H2;1-4H;3-4H,1-2H2 |
| InChIKey | RYVWZARUCCWTNF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|