C29H23BF2N2OS2 — CID 165074280
12,12-difluoro-17-methoxy-7-methyl-10,14-bis(5-methylthiophen-2-yl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene (PubChem CID 165074280) has the molecular formula C29H23BF2N2OS2 and a molecular weight of 528.46 g/mol. Its IUPAC name is 12,12-difluoro-17-methoxy-7-methyl-10,14-bis(5-methylthiophen-2-yl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene.
| Compound Name | 12,12-difluoro-17-methoxy-7-methyl-10,14-bis(5-methylthiophen-2-yl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
|---|---|
| PubChem CID | 165074280 |
| Molecular Formula | C29H23BF2N2OS2 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 12,12-difluoro-17-methoxy-7-methyl-10,14-bis(5-methylthiophen-2-yl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),5,7,10,14,16,18-nonaene |
| SMILES | COc1ccc2c3n(c(-c4ccc(C)s4)c2c1)[B-](F)(F)[N+]1=C(c2ccc(C)s2)c2cc(C)ccc2C1=C3 |
| InChI | InChI=1S/C29H23BF2N2OS2/c1-16-5-9-20-22(13-16)28(26-11-6-17(2)36-26)33-24(20)15-25-21-10-8-19(35-4)14-23(21)29(34(25)30(33,31)32)27-12-7-18(3)37-27/h5-15H,1-4H3 |
| InChIKey | XZGJFYISLDUTGJ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|