About (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane
(E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane (PubChem CID 165078646) has the molecular formula C5H7F5O
and a molecular weight of 178.10 g/mol. Its IUPAC name is (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane.
Analyze (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane?
The IUPAC name of (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane (CID 165078646) is (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane.
What is the SMILES notation for (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane?
The canonical SMILES for (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane is C/C(F)=C\F.COC(F)(F)F.
What is the InChIKey of (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane?
The InChIKey is UTBSLWIQHINCBM-SQQVDAMQSA-N. The full InChI is InChI=1S/C3H4F2.C2H3F3O/c1-3(5)2-4;1-6-2(3,4)5/h2H,1H3;1H3/b3-2+;.
What are the key properties of (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane?
(E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane has a molecular weight of 178.10 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-difluoroprop-1-ene;trifluoro(methoxy)methane is sourced from PubChem (CID 165078646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).