C26H35N3O4 — CID 165084693
3-[6-[4-hydroxy-1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165084693) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[6-[4-hydroxy-1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-hydroxy-1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165084693 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 3-[6-[4-hydroxy-1-[(4-methylcyclohexyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CCC(CN2CCC(O)(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C26H35N3O4/c1-17-2-4-18(5-3-17)15-28-12-10-26(33,11-13-28)20-6-7-21-19(14-20)16-29(25(21)32)22-8-9-23(30)27-24(22)31/h6-7,14,17-18,22,33H,2-5,8-13,15-16H2,1H3,(H,27,30,31) |
| InChIKey | VRSWQMMFCFYPOF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|