C18H24N4O3 — CID 165087943
N-(2,4-dioxocyclohexyl)-N-methyl-2-(5-piperazin-1-yl-3-pyridinyl)acetamide (PubChem CID 165087943) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(2,4-dioxocyclohexyl)-N-methyl-2-(5-piperazin-1-yl-3-pyridinyl)acetamide.
| Compound Name | N-(2,4-dioxocyclohexyl)-N-methyl-2-(5-piperazin-1-yl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 165087943 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(2,4-dioxocyclohexyl)-N-methyl-2-(5-piperazin-1-yl-3-pyridinyl)acetamide |
| SMILES | CN(C(=O)Cc1cncc(N2CCNCC2)c1)C1CCC(=O)CC1=O |
| InChI | InChI=1S/C18H24N4O3/c1-21(16-3-2-15(23)10-17(16)24)18(25)9-13-8-14(12-20-11-13)22-6-4-19-5-7-22/h8,11-12,16,19H,2-7,9-10H2,1H3 |
| InChIKey | HAYXVYFQMAVYOT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|