C14H16N2O4 — CID 167584122
ethyl 2-[5-(2,4-dioxopiperidin-1-yl)-3-pyridinyl]acetate (PubChem CID 167584122) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is ethyl 2-[5-(2,4-dioxopiperidin-1-yl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-(2,4-dioxopiperidin-1-yl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 167584122 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ethyl 2-[5-(2,4-dioxopiperidin-1-yl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cncc(N2CCC(=O)CC2=O)c1 |
| InChI | InChI=1S/C14H16N2O4/c1-2-20-14(19)6-10-5-11(9-15-8-10)16-4-3-12(17)7-13(16)18/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | YSYSZTJRLFMOAS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|