C20H24F3N3O6 — CID 165089466
N-[(3S,6R)-6-[5-(2-ethoxyethoxy)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 165089466) has the molecular formula C20H24F3N3O6 and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[(3S,6R)-6-[5-(2-ethoxyethoxy)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(3S,6R)-6-[5-(2-ethoxyethoxy)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 165089466 |
| Molecular Formula | C20H24F3N3O6 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[(3S,6R)-6-[5-(2-ethoxyethoxy)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CCOCCOc1nnc([C@H]2CC[C@H](NC(=O)COc3ccc(C(F)(F)F)cc3)CO2)o1 |
| InChI | InChI=1S/C20H24F3N3O6/c1-2-28-9-10-29-19-26-25-18(32-19)16-8-5-14(11-31-16)24-17(27)12-30-15-6-3-13(4-7-15)20(21,22)23/h3-4,6-7,14,16H,2,5,8-12H2,1H3,(H,24,27)/t14-,16+/m0/s1 |
| InChIKey | QTRSBRGVSQSQBZ-GOEBONIOSA-N |
| XLogP | 2.92 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|